About 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide
5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide (PubChem CID 138018113) has the molecular formula C11H18N2O4S
and a molecular weight of 274.34 g/mol. Its IUPAC name is 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide.
Molecular Properties
| Compound Name | 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide |
| PubChem CID | 138018113 |
| Molecular Formula | C11H18N2O4S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide |
| SMILES | CC1(C)CC(S(=O)(=O)NCCc2cnoc2)CO1 |
| InChI | InChI=1S/C11H18N2O4S/c1-11(2)5-10(8-16-11)18(14,15)13-4-3-9-6-12-17-7-9/h6-7,10,13H,3-5,8H2,1-2H3 |
| InChIKey | AUUWMHTVCOXVDW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide?
The IUPAC name of 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide (CID 138018113) is 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide.
What is the SMILES notation for 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide?
The canonical SMILES for 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide is CC1(C)CC(S(=O)(=O)NCCc2cnoc2)CO1.
What is the InChIKey of 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide?
The InChIKey is AUUWMHTVCOXVDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O4S/c1-11(2)5-10(8-16-11)18(14,15)13-4-3-9-6-12-17-7-9/h6-7,10,13H,3-5,8H2,1-2H3.
What are the key properties of 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide?
5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide has a molecular weight of 274.34 g/mol, XLogP of 0.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-N-[2-(1,2-oxazol-4-yl)ethyl]oxolane-3-sulfonamide is sourced from PubChem (CID 138018113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).