About N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide
N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 138018354) has the molecular formula C11H22N2O3
and a molecular weight of 230.31 g/mol. Its IUPAC name is N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide |
| PubChem CID | 138018354 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1CC(CO)CC1CO |
| InChI | InChI=1S/C11H22N2O3/c1-2-3-4-12-11(16)13-6-9(7-14)5-10(13)8-15/h9-10,14-15H,2-8H2,1H3,(H,12,16) |
| InChIKey | PPXJQVDEIUBYDP-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide?
The IUPAC name of N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide (CID 138018354) is N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide.
What is the SMILES notation for N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide?
The canonical SMILES for N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide is CCCCNC(=O)N1CC(CO)CC1CO.
What is the InChIKey of N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide?
The InChIKey is PPXJQVDEIUBYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O3/c1-2-3-4-12-11(16)13-6-9(7-14)5-10(13)8-15/h9-10,14-15H,2-8H2,1H3,(H,12,16).
What are the key properties of N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide?
N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide has a molecular weight of 230.31 g/mol, XLogP of 0.17, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-2,4-bis(hydroxymethyl)pyrrolidine-1-carboxamide is sourced from PubChem (CID 138018354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).