About 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide
3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide (PubChem CID 138018527) has the molecular formula C13H18BrN3O2
and a molecular weight of 328.21 g/mol. Its IUPAC name is 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide |
| PubChem CID | 138018527 |
| Molecular Formula | C13H18BrN3O2 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(NC[C@H]2CCCC[C@@H]2O)c1Br |
| InChI | InChI=1S/C13H18BrN3O2/c14-11-9(12(15)19)5-6-16-13(11)17-7-8-3-1-2-4-10(8)18/h5-6,8,10,18H,1-4,7H2,(H2,15,19)(H,16,17)/t8-,10+/m1/s1 |
| InChIKey | JSKSDGZZOSPALV-SCZZXKLOSA-N |
| XLogP | 1.91 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide?
The IUPAC name of 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide (CID 138018527) is 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide.
What is the SMILES notation for 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide?
The canonical SMILES for 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide is NC(=O)c1ccnc(NC[C@H]2CCCC[C@@H]2O)c1Br.
What is the InChIKey of 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide?
The InChIKey is JSKSDGZZOSPALV-SCZZXKLOSA-N. The full InChI is InChI=1S/C13H18BrN3O2/c14-11-9(12(15)19)5-6-16-13(11)17-7-8-3-1-2-4-10(8)18/h5-6,8,10,18H,1-4,7H2,(H2,15,19)(H,16,17)/t8-,10+/m1/s1.
What are the key properties of 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide?
3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide has a molecular weight of 328.21 g/mol, XLogP of 1.91, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-[[(1R,2S)-2-hydroxycyclohexyl]methylamino]pyridine-4-carboxamide is sourced from PubChem (CID 138018527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).