C16H20F3N3O2 — CID 138018878
(3aS,6aS)-N-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide (PubChem CID 138018878) has the molecular formula C16H20F3N3O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is (3aS,6aS)-N-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide.
| Compound Name | (3aS,6aS)-N-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 138018878 |
| Molecular Formula | C16H20F3N3O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (3aS,6aS)-N-[[6-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]pyrrole-1-carboxamide |
| SMILES | O=C(NCc1cccc(OCC(F)(F)F)n1)N1CC[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C16H20F3N3O2/c17-16(18,19)10-24-14-6-2-4-12(21-14)9-20-15(23)22-8-7-11-3-1-5-13(11)22/h2,4,6,11,13H,1,3,5,7-10H2,(H,20,23)/t11-,13-/m0/s1 |
| InChIKey | SGYQJZRPSCFUQP-AAEUAGOBSA-N |
| XLogP | 3.11 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |