About 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine
2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 138019297) has the molecular formula C13H19F3N4
and a molecular weight of 288.32 g/mol. Its IUPAC name is 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine.
Molecular Properties
| Compound Name | 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine |
| PubChem CID | 138019297 |
| Molecular Formula | C13H19F3N4 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | CCN1[C@H](C)CN(c2nccc(C(F)(F)F)n2)C[C@@H]1C |
| InChI | InChI=1S/C13H19F3N4/c1-4-20-9(2)7-19(8-10(20)3)12-17-6-5-11(18-12)13(14,15)16/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+ |
| InChIKey | VHXSBKGHTIVFCX-AOOOYVTPSA-N |
| XLogP | 2.41 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
The IUPAC name of 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine (CID 138019297) is 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine.
What is the SMILES notation for 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
The canonical SMILES for 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine is CCN1[C@H](C)CN(c2nccc(C(F)(F)F)n2)C[C@@H]1C.
What is the InChIKey of 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
The InChIKey is VHXSBKGHTIVFCX-AOOOYVTPSA-N. The full InChI is InChI=1S/C13H19F3N4/c1-4-20-9(2)7-19(8-10(20)3)12-17-6-5-11(18-12)13(14,15)16/h5-6,9-10H,4,7-8H2,1-3H3/t9-,10+.
What are the key properties of 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine?
2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine has a molecular weight of 288.32 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,5R)-4-ethyl-3,5-dimethylpiperazin-1-yl]-4-(trifluoromethyl)pyrimidine is sourced from PubChem (CID 138019297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).