C15H17ClN4O — CID 138020211
2-chloro-6-[[(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)amino]methyl]phenol (PubChem CID 138020211) has the molecular formula C15H17ClN4O and a molecular weight of 304.78 g/mol. Its IUPAC name is 2-chloro-6-[[(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)amino]methyl]phenol.
| Compound Name | 2-chloro-6-[[(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 138020211 |
| Molecular Formula | C15H17ClN4O |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-chloro-6-[[(6-methyl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-yl)amino]methyl]phenol |
| SMILES | CN1CCc2ncnc(NCc3cccc(Cl)c3O)c2C1 |
| InChI | InChI=1S/C15H17ClN4O/c1-20-6-5-13-11(8-20)15(19-9-18-13)17-7-10-3-2-4-12(16)14(10)21/h2-4,9,21H,5-8H2,1H3,(H,17,18,19) |
| InChIKey | JVYPXHBGIOJVPL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|