C15H19N3O2S — CID 138020987
N-(4-methoxybutyl)-N-methyl-3-phenyl-1,2,4-thiadiazole-5-carboxamide (PubChem CID 138020987) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-(4-methoxybutyl)-N-methyl-3-phenyl-1,2,4-thiadiazole-5-carboxamide.
| Compound Name | N-(4-methoxybutyl)-N-methyl-3-phenyl-1,2,4-thiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 138020987 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-(4-methoxybutyl)-N-methyl-3-phenyl-1,2,4-thiadiazole-5-carboxamide |
| SMILES | COCCCCN(C)C(=O)c1nc(-c2ccccc2)ns1 |
| InChI | InChI=1S/C15H19N3O2S/c1-18(10-6-7-11-20-2)15(19)14-16-13(17-21-14)12-8-4-3-5-9-12/h3-5,8-9H,6-7,10-11H2,1-2H3 |
| InChIKey | QVFSLAYDNVRRIF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|