C16H19N3O3S — CID 138021720
N-(2,2-dimethyl-1,1-dioxothian-4-yl)quinoxaline-2-carboxamide (PubChem CID 138021720) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,1-dioxothian-4-yl)quinoxaline-2-carboxamide.
| Compound Name | N-(2,2-dimethyl-1,1-dioxothian-4-yl)quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 138021720 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | N-(2,2-dimethyl-1,1-dioxothian-4-yl)quinoxaline-2-carboxamide |
| SMILES | CC1(C)CC(NC(=O)c2cnc3ccccc3n2)CCS1(=O)=O |
| InChI | InChI=1S/C16H19N3O3S/c1-16(2)9-11(7-8-23(16,21)22)18-15(20)14-10-17-12-5-3-4-6-13(12)19-14/h3-6,10-11H,7-9H2,1-2H3,(H,18,20) |
| InChIKey | FFDYMKKKBYRRBQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |