C17H16Br3NO3 — CID 1380224
4-methyl-N-[(1R)-2,2,2-tribromo-1-(2-methoxyphenoxy)ethyl]benzamide (PubChem CID 1380224) has the molecular formula C17H16Br3NO3 and a molecular weight of 522.03 g/mol. Its IUPAC name is 4-methyl-N-[(1R)-2,2,2-tribromo-1-(2-methoxyphenoxy)ethyl]benzamide.
| Compound Name | 4-methyl-N-[(1R)-2,2,2-tribromo-1-(2-methoxyphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 1380224 |
| Molecular Formula | C17H16Br3NO3 |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 518.87 |
| IUPAC Name | 4-methyl-N-[(1R)-2,2,2-tribromo-1-(2-methoxyphenoxy)ethyl]benzamide |
| SMILES | COc1ccccc1O[C@@H](NC(=O)c1ccc(C)cc1)C(Br)(Br)Br |
| InChI | InChI=1S/C17H16Br3NO3/c1-11-7-9-12(10-8-11)15(22)21-16(17(18,19)20)24-14-6-4-3-5-13(14)23-2/h3-10,16H,1-2H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | PRQGYURUJICDIJ-MRXNPFEDSA-N |
| XLogP | 4.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|