About 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide
2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide (PubChem CID 138022631) has the molecular formula C17H27N5O3
and a molecular weight of 349.44 g/mol. Its IUPAC name is 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide |
| PubChem CID | 138022631 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide |
| SMILES | CC1CN(c2cc(C(N)=O)nc(N3CCCOC(C)C3)n2)CCCO1 |
| InChI | InChI=1S/C17H27N5O3/c1-12-10-21(5-3-7-24-12)15-9-14(16(18)23)19-17(20-15)22-6-4-8-25-13(2)11-22/h9,12-13H,3-8,10-11H2,1-2H3,(H2,18,23) |
| InChIKey | JUKBNPCAPQNAJA-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide?
The IUPAC name of 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide (CID 138022631) is 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide.
What is the SMILES notation for 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide?
The canonical SMILES for 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide is CC1CN(c2cc(C(N)=O)nc(N3CCCOC(C)C3)n2)CCCO1.
What is the InChIKey of 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide?
The InChIKey is JUKBNPCAPQNAJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N5O3/c1-12-10-21(5-3-7-24-12)15-9-14(16(18)23)19-17(20-15)22-6-4-8-25-13(2)11-22/h9,12-13H,3-8,10-11H2,1-2H3,(H2,18,23).
What are the key properties of 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide?
2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide has a molecular weight of 349.44 g/mol, XLogP of 0.81, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(2-methyl-1,4-oxazepan-4-yl)pyrimidine-4-carboxamide is sourced from PubChem (CID 138022631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).