C18H25N3O3 — CID 138022708
(3aR,6aR)-2-N-(2-methoxy-1-phenylethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide (PubChem CID 138022708) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3aR,6aR)-2-N-(2-methoxy-1-phenylethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide.
| Compound Name | (3aR,6aR)-2-N-(2-methoxy-1-phenylethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide |
|---|---|
| PubChem CID | 138022708 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (3aR,6aR)-2-N-(2-methoxy-1-phenylethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2,3a-dicarboxamide |
| SMILES | COCC(NC(=O)N1C[C@@H]2CCC[C@]2(C(N)=O)C1)c1ccccc1 |
| InChI | InChI=1S/C18H25N3O3/c1-24-11-15(13-6-3-2-4-7-13)20-17(23)21-10-14-8-5-9-18(14,12-21)16(19)22/h2-4,6-7,14-15H,5,8-12H2,1H3,(H2,19,22)(H,20,23)/t14-,15?,18-/m0/s1 |
| InChIKey | MOLMNKWHQOAHKQ-RARQCXRASA-N |
| XLogP | 1.67 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |