C19H16FN5O — CID 138023073
2-[1-(2-fluorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole (PubChem CID 138023073) has the molecular formula C19H16FN5O and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole.
| Compound Name | 2-[1-(2-fluorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole |
|---|---|
| PubChem CID | 138023073 |
| Molecular Formula | C19H16FN5O |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[1-(2-fluorophenyl)pyrazolo[5,4-d]pyrimidin-4-yl]-1,3,3a,4,7,7a-hexahydro-4,7-epoxyisoindole |
| SMILES | Fc1ccccc1-n1ncc2c(N3CC4C5C=CC(O5)C4C3)ncnc21 |
| InChI | InChI=1S/C19H16FN5O/c20-14-3-1-2-4-15(14)25-19-11(7-23-25)18(21-10-22-19)24-8-12-13(9-24)17-6-5-16(12)26-17/h1-7,10,12-13,16-17H,8-9H2 |
| InChIKey | BVNLRPCJGXKFCW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|