C13H13F2N3O3S — CID 138023239
9-[2-(difluoromethyl)thiophene-3-carbonyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione (PubChem CID 138023239) has the molecular formula C13H13F2N3O3S and a molecular weight of 329.33 g/mol. Its IUPAC name is 9-[2-(difluoromethyl)thiophene-3-carbonyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 9-[2-(difluoromethyl)thiophene-3-carbonyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 138023239 |
| Molecular Formula | C13H13F2N3O3S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 9-[2-(difluoromethyl)thiophene-3-carbonyl]-1,3,9-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCCN(C(=O)c3ccsc3C(F)F)C2)N1 |
| InChI | InChI=1S/C13H13F2N3O3S/c14-9(15)8-7(2-5-22-8)10(19)18-4-1-3-13(6-18)11(20)16-12(21)17-13/h2,5,9H,1,3-4,6H2,(H2,16,17,20,21) |
| InChIKey | RVUNCLHMCMKCEU-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|