About 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one
2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one (PubChem CID 138024141) has the molecular formula C14H16F3NO5
and a molecular weight of 335.28 g/mol. Its IUPAC name is 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one.
Molecular Properties
| Compound Name | 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one |
| PubChem CID | 138024141 |
| Molecular Formula | C14H16F3NO5 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one |
| SMILES | Cc1occc(=O)c1OCC(=O)N1CCO[C@@H](C(F)(F)F)[C@H]1C |
| InChI | InChI=1S/C14H16F3NO5/c1-8-13(14(15,16)17)22-6-4-18(8)11(20)7-23-12-9(2)21-5-3-10(12)19/h3,5,8,13H,4,6-7H2,1-2H3/t8-,13-/m1/s1 |
| InChIKey | HRBZLMCQTPOYNY-AMIZOPFISA-N |
| XLogP | 1.51 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one?
The IUPAC name of 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one (CID 138024141) is 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one.
What is the SMILES notation for 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one?
The canonical SMILES for 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one is Cc1occc(=O)c1OCC(=O)N1CCO[C@@H](C(F)(F)F)[C@H]1C.
What is the InChIKey of 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one?
The InChIKey is HRBZLMCQTPOYNY-AMIZOPFISA-N. The full InChI is InChI=1S/C14H16F3NO5/c1-8-13(14(15,16)17)22-6-4-18(8)11(20)7-23-12-9(2)21-5-3-10(12)19/h3,5,8,13H,4,6-7H2,1-2H3/t8-,13-/m1/s1.
What are the key properties of 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one?
2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one has a molecular weight of 335.28 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3-[2-[(2R,3R)-3-methyl-2-(trifluoromethyl)morpholin-4-yl]-2-oxoethoxy]pyran-4-one is sourced from PubChem (CID 138024141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).