C16H24N2O4S — CID 138024621
(2-methylfuran-3-yl)-(4-piperidin-1-ylsulfonylpiperidin-1-yl)methanone (PubChem CID 138024621) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is (2-methylfuran-3-yl)-(4-piperidin-1-ylsulfonylpiperidin-1-yl)methanone.
| Compound Name | (2-methylfuran-3-yl)-(4-piperidin-1-ylsulfonylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 138024621 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2-methylfuran-3-yl)-(4-piperidin-1-ylsulfonylpiperidin-1-yl)methanone |
| SMILES | Cc1occc1C(=O)N1CCC(S(=O)(=O)N2CCCCC2)CC1 |
| InChI | InChI=1S/C16H24N2O4S/c1-13-15(7-12-22-13)16(19)17-10-5-14(6-11-17)23(20,21)18-8-3-2-4-9-18/h7,12,14H,2-6,8-11H2,1H3 |
| InChIKey | XIKMYVIPHFVIAF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |