C15H14FN3O2 — CID 138024731
N-[3-(2-fluorophenyl)oxetan-3-yl]-5-methylpyrazine-2-carboxamide (PubChem CID 138024731) has the molecular formula C15H14FN3O2 and a molecular weight of 287.29 g/mol. Its IUPAC name is N-[3-(2-fluorophenyl)oxetan-3-yl]-5-methylpyrazine-2-carboxamide.
| Compound Name | N-[3-(2-fluorophenyl)oxetan-3-yl]-5-methylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 138024731 |
| Molecular Formula | C15H14FN3O2 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | N-[3-(2-fluorophenyl)oxetan-3-yl]-5-methylpyrazine-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC2(c3ccccc3F)COC2)cn1 |
| InChI | InChI=1S/C15H14FN3O2/c1-10-6-18-13(7-17-10)14(20)19-15(8-21-9-15)11-4-2-3-5-12(11)16/h2-7H,8-9H2,1H3,(H,19,20) |
| InChIKey | YVUMYVSOYMIEHW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |