About N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide
N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide (PubChem CID 138025273) has the molecular formula C11H17N3O5S2
and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide.
Molecular Properties
| Compound Name | N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide |
| PubChem CID | 138025273 |
| Molecular Formula | C11H17N3O5S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide |
| SMILES | COc1cnc(NC(=O)N2CCOC(CS(C)(=O)=O)C2)s1 |
| InChI | InChI=1S/C11H17N3O5S2/c1-18-9-5-12-10(20-9)13-11(15)14-3-4-19-8(6-14)7-21(2,16)17/h5,8H,3-4,6-7H2,1-2H3,(H,12,13,15) |
| InChIKey | RJXPPYAZLVOLJN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide?
The IUPAC name of N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide (CID 138025273) is N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide.
What is the SMILES notation for N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide?
The canonical SMILES for N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide is COc1cnc(NC(=O)N2CCOC(CS(C)(=O)=O)C2)s1.
What is the InChIKey of N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide?
The InChIKey is RJXPPYAZLVOLJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O5S2/c1-18-9-5-12-10(20-9)13-11(15)14-3-4-19-8(6-14)7-21(2,16)17/h5,8H,3-4,6-7H2,1-2H3,(H,12,13,15).
What are the key properties of N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide?
N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide has a molecular weight of 335.41 g/mol, XLogP of 0.43, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methoxy-1,3-thiazol-2-yl)-2-(methylsulfonylmethyl)morpholine-4-carboxamide is sourced from PubChem (CID 138025273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).