C17H20N2O2S — CID 138026423
6-cyclopropyl-N-methyl-2-oxo-N-(1-thiophen-3-ylpropan-2-yl)-1H-pyridine-3-carboxamide (PubChem CID 138026423) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is 6-cyclopropyl-N-methyl-2-oxo-N-(1-thiophen-3-ylpropan-2-yl)-1H-pyridine-3-carboxamide.
| Compound Name | 6-cyclopropyl-N-methyl-2-oxo-N-(1-thiophen-3-ylpropan-2-yl)-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138026423 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 6-cyclopropyl-N-methyl-2-oxo-N-(1-thiophen-3-ylpropan-2-yl)-1H-pyridine-3-carboxamide |
| SMILES | CC(Cc1ccsc1)N(C)C(=O)c1ccc(C2CC2)[nH]c1=O |
| InChI | InChI=1S/C17H20N2O2S/c1-11(9-12-7-8-22-10-12)19(2)17(21)14-5-6-15(13-3-4-13)18-16(14)20/h5-8,10-11,13H,3-4,9H2,1-2H3,(H,18,20) |
| InChIKey | HFYPUSWYVHKFNO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |