C17H17ClN4O2 — CID 138026945
7-chloro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1-benzofuran-4-carboxamide (PubChem CID 138026945) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 7-chloro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1-benzofuran-4-carboxamide.
| Compound Name | 7-chloro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 138026945 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 7-chloro-N-[2-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]-1-benzofuran-4-carboxamide |
| SMILES | O=C(NCCc1nnc2n1CCCC2)c1ccc(Cl)c2occc12 |
| InChI | InChI=1S/C17H17ClN4O2/c18-13-5-4-12(11-7-10-24-16(11)13)17(23)19-8-6-15-21-20-14-3-1-2-9-22(14)15/h4-5,7,10H,1-3,6,8-9H2,(H,19,23) |
| InChIKey | NYPKGEHUNPBCFI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |