C13H17F3N4O3 — CID 138027045
N-(5-methoxy-1-methylpyrazol-3-yl)-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 138027045) has the molecular formula C13H17F3N4O3 and a molecular weight of 334.30 g/mol. Its IUPAC name is N-(5-methoxy-1-methylpyrazol-3-yl)-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | N-(5-methoxy-1-methylpyrazol-3-yl)-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 138027045 |
| Molecular Formula | C13H17F3N4O3 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | N-(5-methoxy-1-methylpyrazol-3-yl)-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | COc1cc(NC(=O)C2CCCN(CC(F)(F)F)C2=O)nn1C |
| InChI | InChI=1S/C13H17F3N4O3/c1-19-10(23-2)6-9(18-19)17-11(21)8-4-3-5-20(12(8)22)7-13(14,15)16/h6,8H,3-5,7H2,1-2H3,(H,17,18,21) |
| InChIKey | JHFLVQGDJFRGOL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|