About N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide
N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide (PubChem CID 138027801) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide.
Molecular Properties
| Compound Name | N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide |
| PubChem CID | 138027801 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide |
| SMILES | CCc1cc(NC(=O)N2CCC3(CC2)CC(O)CCO3)no1 |
| InChI | InChI=1S/C15H23N3O4/c1-2-12-9-13(17-22-12)16-14(20)18-6-4-15(5-7-18)10-11(19)3-8-21-15/h9,11,19H,2-8,10H2,1H3,(H,16,17,20) |
| InChIKey | LBHQUIXIRAFADW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide?
The IUPAC name of N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide (CID 138027801) is N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide.
What is the SMILES notation for N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide?
The canonical SMILES for N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide is CCc1cc(NC(=O)N2CCC3(CC2)CC(O)CCO3)no1.
What is the InChIKey of N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide?
The InChIKey is LBHQUIXIRAFADW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4/c1-2-12-9-13(17-22-12)16-14(20)18-6-4-15(5-7-18)10-11(19)3-8-21-15/h9,11,19H,2-8,10H2,1H3,(H,16,17,20).
What are the key properties of N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide?
N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide has a molecular weight of 309.37 g/mol, XLogP of 1.77, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-ethyl-1,2-oxazol-3-yl)-4-hydroxy-1-oxa-9-azaspiro[5.5]undecane-9-carboxamide is sourced from PubChem (CID 138027801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).