About 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea
1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea (PubChem CID 138028054) has the molecular formula C15H21N5O2
and a molecular weight of 303.37 g/mol. Its IUPAC name is 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea.
Molecular Properties
| Compound Name | 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea |
| PubChem CID | 138028054 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea |
| SMILES | CCc1onc(C)c1NC(=O)NCc1cc(C2CC2)nn1C |
| InChI | InChI=1S/C15H21N5O2/c1-4-13-14(9(2)19-22-13)17-15(21)16-8-11-7-12(10-5-6-10)18-20(11)3/h7,10H,4-6,8H2,1-3H3,(H2,16,17,21) |
| InChIKey | RTFVYGWKRLUWAS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 84.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea?
The IUPAC name of 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea (CID 138028054) is 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea.
What is the SMILES notation for 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea?
The canonical SMILES for 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea is CCc1onc(C)c1NC(=O)NCc1cc(C2CC2)nn1C.
What is the InChIKey of 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea?
The InChIKey is RTFVYGWKRLUWAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O2/c1-4-13-14(9(2)19-22-13)17-15(21)16-8-11-7-12(10-5-6-10)18-20(11)3/h7,10H,4-6,8H2,1-3H3,(H2,16,17,21).
What are the key properties of 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea?
1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea has a molecular weight of 303.37 g/mol, XLogP of 2.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-cyclopropyl-1-methylpyrazol-5-yl)methyl]-3-(5-ethyl-3-methyl-1,2-oxazol-4-yl)urea is sourced from PubChem (CID 138028054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).