C19H25NO4 — CID 138029154
2-[4-[1-[[(4Z)-cyclooct-4-ene-1-carbonyl]amino]ethyl]phenoxy]acetic acid (PubChem CID 138029154) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[4-[1-[[(4Z)-cyclooct-4-ene-1-carbonyl]amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[1-[[(4Z)-cyclooct-4-ene-1-carbonyl]amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 138029154 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 2-[4-[1-[[(4Z)-cyclooct-4-ene-1-carbonyl]amino]ethyl]phenoxy]acetic acid |
| SMILES | CC(NC(=O)C1CC/C=C\CCC1)c1ccc(OCC(=O)O)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-14(15-9-11-17(12-10-15)24-13-18(21)22)20-19(23)16-7-5-3-2-4-6-8-16/h2-3,9-12,14,16H,4-8,13H2,1H3,(H,20,23)(H,21,22)/b3-2- |
| InChIKey | ADBVMJRXSDVRQV-IHWYPQMZSA-N |
| XLogP | 3.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|