About 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea
1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea (PubChem CID 138030077) has the molecular formula C16H24N4O3
and a molecular weight of 320.39 g/mol. Its IUPAC name is 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea.
Molecular Properties
| Compound Name | 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea |
| PubChem CID | 138030077 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea |
| SMILES | CCC1CCCC1NC(=O)NCc1cn(C2CC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H24N4O3/c1-2-10-4-3-5-13(10)18-15(22)17-8-11-9-20(12-6-7-12)16(23)19-14(11)21/h9-10,12-13H,2-8H2,1H3,(H2,17,18,22)(H,19,21,23) |
| InChIKey | QAHLZHGQZTZNNY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea?
The IUPAC name of 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea (CID 138030077) is 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea.
What is the SMILES notation for 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea?
The canonical SMILES for 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea is CCC1CCCC1NC(=O)NCc1cn(C2CC2)c(=O)[nH]c1=O.
What is the InChIKey of 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea?
The InChIKey is QAHLZHGQZTZNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O3/c1-2-10-4-3-5-13(10)18-15(22)17-8-11-9-20(12-6-7-12)16(23)19-14(11)21/h9-10,12-13H,2-8H2,1H3,(H2,17,18,22)(H,19,21,23).
What are the key properties of 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea?
1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea has a molecular weight of 320.39 g/mol, XLogP of 1.25, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-cyclopropyl-2,4-dioxopyrimidin-5-yl)methyl]-3-(2-ethylcyclopentyl)urea is sourced from PubChem (CID 138030077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).