About 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide
3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide (PubChem CID 138030894) has the molecular formula C20H21FN2O2
and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide |
| PubChem CID | 138030894 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide |
| SMILES | CC1Cc2cccc(F)c2N(C(=O)c2cccc(C(=O)N(C)C)c2)C1 |
| InChI | InChI=1S/C20H21FN2O2/c1-13-10-14-6-5-9-17(21)18(14)23(12-13)20(25)16-8-4-7-15(11-16)19(24)22(2)3/h4-9,11,13H,10,12H2,1-3H3 |
| InChIKey | HSGXNHNBRKRXNZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide?
The IUPAC name of 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide (CID 138030894) is 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide.
What is the SMILES notation for 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide?
The canonical SMILES for 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide is CC1Cc2cccc(F)c2N(C(=O)c2cccc(C(=O)N(C)C)c2)C1.
What is the InChIKey of 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide?
The InChIKey is HSGXNHNBRKRXNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O2/c1-13-10-14-6-5-9-17(21)18(14)23(12-13)20(25)16-8-4-7-15(11-16)19(24)22(2)3/h4-9,11,13H,10,12H2,1-3H3.
What are the key properties of 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide?
3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide has a molecular weight of 340.40 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-fluoro-3-methyl-3,4-dihydro-2H-quinoline-1-carbonyl)-N,N-dimethylbenzamide is sourced from PubChem (CID 138030894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).