About 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine
6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine (PubChem CID 138031055) has the molecular formula C13H17N5
and a molecular weight of 243.31 g/mol. Its IUPAC name is 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine |
| PubChem CID | 138031055 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1[nH]nc(CNc2cc(C3CC3)ncn2)c1C |
| InChI | InChI=1S/C13H17N5/c1-8-9(2)17-18-12(8)6-14-13-5-11(10-3-4-10)15-7-16-13/h5,7,10H,3-4,6H2,1-2H3,(H,17,18)(H,14,15,16) |
| InChIKey | QOGPLCISNQDDLH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine?
The IUPAC name of 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine (CID 138031055) is 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine.
What is the SMILES notation for 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine?
The canonical SMILES for 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine is Cc1[nH]nc(CNc2cc(C3CC3)ncn2)c1C.
What is the InChIKey of 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine?
The InChIKey is QOGPLCISNQDDLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5/c1-8-9(2)17-18-12(8)6-14-13-5-11(10-3-4-10)15-7-16-13/h5,7,10H,3-4,6H2,1-2H3,(H,17,18)(H,14,15,16).
What are the key properties of 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine?
6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine has a molecular weight of 243.31 g/mol, XLogP of 2.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopropyl-N-[(4,5-dimethyl-1H-pyrazol-3-yl)methyl]pyrimidin-4-amine is sourced from PubChem (CID 138031055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).