About 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine
4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 138031216) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine |
| PubChem CID | 138031216 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | CCc1csc(NCc2nocc2C)n1 |
| InChI | InChI=1S/C10H13N3OS/c1-3-8-6-15-10(12-8)11-4-9-7(2)5-14-13-9/h5-6H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | RHCPOAKPZPEVHQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine?
The IUPAC name of 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine (CID 138031216) is 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine.
What is the SMILES notation for 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine?
The canonical SMILES for 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine is CCc1csc(NCc2nocc2C)n1.
What is the InChIKey of 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine?
The InChIKey is RHCPOAKPZPEVHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS/c1-3-8-6-15-10(12-8)11-4-9-7(2)5-14-13-9/h5-6H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine?
4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine has a molecular weight of 223.30 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-[(4-methyl-1,2-oxazol-3-yl)methyl]-1,3-thiazol-2-amine is sourced from PubChem (CID 138031216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).