About 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid
5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid (PubChem CID 138032645) has the molecular formula C19H23NO5
and a molecular weight of 345.39 g/mol. Its IUPAC name is 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid |
| PubChem CID | 138032645 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid |
| SMILES | CC1(C)CN(Cc2cc(C(=O)O)co2)CC(COc2ccccc2)O1 |
| InChI | InChI=1S/C19H23NO5/c1-19(2)13-20(9-16-8-14(11-23-16)18(21)22)10-17(25-19)12-24-15-6-4-3-5-7-15/h3-8,11,17H,9-10,12-13H2,1-2H3,(H,21,22) |
| InChIKey | INIPCHNUZGOICI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid?
The IUPAC name of 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid (CID 138032645) is 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid.
What is the SMILES notation for 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid?
The canonical SMILES for 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid is CC1(C)CN(Cc2cc(C(=O)O)co2)CC(COc2ccccc2)O1.
What is the InChIKey of 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid?
The InChIKey is INIPCHNUZGOICI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO5/c1-19(2)13-20(9-16-8-14(11-23-16)18(21)22)10-17(25-19)12-24-15-6-4-3-5-7-15/h3-8,11,17H,9-10,12-13H2,1-2H3,(H,21,22).
What are the key properties of 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid?
5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid has a molecular weight of 345.39 g/mol, XLogP of 3.04, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2,2-dimethyl-6-(phenoxymethyl)morpholin-4-yl]methyl]furan-3-carboxylic acid is sourced from PubChem (CID 138032645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).