C15H25N7 — CID 138033007
3-tert-butyl-7-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 138033007) has the molecular formula C15H25N7 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-tert-butyl-7-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 3-tert-butyl-7-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 138033007 |
| Molecular Formula | C15H25N7 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 3-tert-butyl-7-[(4-ethyl-5-methyl-1,2,4-triazol-3-yl)methyl]-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCn1c(C)nnc1CN1CCn2c(nnc2C(C)(C)C)C1 |
| InChI | InChI=1S/C15H25N7/c1-6-21-11(2)16-17-12(21)9-20-7-8-22-13(10-20)18-19-14(22)15(3,4)5/h6-10H2,1-5H3 |
| InChIKey | YNPLYVXXTWHWJB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |