About 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine
3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine (PubChem CID 138033328) has the molecular formula C20H30N4OS
and a molecular weight of 374.55 g/mol. Its IUPAC name is 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine.
Molecular Properties
| Compound Name | 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine |
| PubChem CID | 138033328 |
| Molecular Formula | C20H30N4OS |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine |
| SMILES | Cc1nn(Cc2nc(C3CCCCC3)cs2)c(C)c1C1COCCN1C |
| InChI | InChI=1S/C20H30N4OS/c1-14-20(18-12-25-10-9-23(18)3)15(2)24(22-14)11-19-21-17(13-26-19)16-7-5-4-6-8-16/h13,16,18H,4-12H2,1-3H3 |
| InChIKey | QCXABOABYYBBOP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine?
The IUPAC name of 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine (CID 138033328) is 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine.
What is the SMILES notation for 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine?
The canonical SMILES for 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine is Cc1nn(Cc2nc(C3CCCCC3)cs2)c(C)c1C1COCCN1C.
What is the InChIKey of 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine?
The InChIKey is QCXABOABYYBBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4OS/c1-14-20(18-12-25-10-9-23(18)3)15(2)24(22-14)11-19-21-17(13-26-19)16-7-5-4-6-8-16/h13,16,18H,4-12H2,1-3H3.
What are the key properties of 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine?
3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine has a molecular weight of 374.55 g/mol, XLogP of 4.06, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[(4-cyclohexyl-1,3-thiazol-2-yl)methyl]-3,5-dimethylpyrazol-4-yl]-4-methylmorpholine is sourced from PubChem (CID 138033328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).