C18H25ClN2O3 — CID 138033878
N-[3-(3-chlorophenyl)cyclobutyl]-3-(hydroxymethyl)-3-methoxypiperidine-1-carboxamide (PubChem CID 138033878) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)cyclobutyl]-3-(hydroxymethyl)-3-methoxypiperidine-1-carboxamide.
| Compound Name | N-[3-(3-chlorophenyl)cyclobutyl]-3-(hydroxymethyl)-3-methoxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 138033878 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[3-(3-chlorophenyl)cyclobutyl]-3-(hydroxymethyl)-3-methoxypiperidine-1-carboxamide |
| SMILES | COC1(CO)CCCN(C(=O)NC2CC(c3cccc(Cl)c3)C2)C1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-24-18(12-22)6-3-7-21(11-18)17(23)20-16-9-14(10-16)13-4-2-5-15(19)8-13/h2,4-5,8,14,16,22H,3,6-7,9-12H2,1H3,(H,20,23) |
| InChIKey | MRAPLMXZNWVUMQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |