C11H15F2N5O2 — CID 138035497
(6,6-difluoro-1,4-oxazepan-4-yl)-(4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone (PubChem CID 138035497) has the molecular formula C11H15F2N5O2 and a molecular weight of 287.27 g/mol. Its IUPAC name is (6,6-difluoro-1,4-oxazepan-4-yl)-(4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone.
| Compound Name | (6,6-difluoro-1,4-oxazepan-4-yl)-(4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
|---|---|
| PubChem CID | 138035497 |
| Molecular Formula | C11H15F2N5O2 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (6,6-difluoro-1,4-oxazepan-4-yl)-(4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methanone |
| SMILES | O=C(c1nc2n(n1)CCCN2)N1CCOCC(F)(F)C1 |
| InChI | InChI=1S/C11H15F2N5O2/c12-11(13)6-17(4-5-20-7-11)9(19)8-15-10-14-2-1-3-18(10)16-8/h1-7H2,(H,14,15,16) |
| InChIKey | HNSAGDVTSNWFFA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |