About N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide
N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (PubChem CID 138035612) has the molecular formula C10H8F3N3O3
and a molecular weight of 275.19 g/mol. Its IUPAC name is N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| PubChem CID | 138035612 |
| Molecular Formula | C10H8F3N3O3 |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ncoc1CNC(=O)c1ncoc1C(F)(F)F |
| InChI | InChI=1S/C10H8F3N3O3/c1-5-6(18-3-15-5)2-14-9(17)7-8(10(11,12)13)19-4-16-7/h3-4H,2H2,1H3,(H,14,17) |
| InChIKey | UOGFHSJMSLUBTE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide (CID 138035612) is N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide is Cc1ncoc1CNC(=O)c1ncoc1C(F)(F)F.
What is the InChIKey of N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
The InChIKey is UOGFHSJMSLUBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3N3O3/c1-5-6(18-3-15-5)2-14-9(17)7-8(10(11,12)13)19-4-16-7/h3-4H,2H2,1H3,(H,14,17).
What are the key properties of N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide?
N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide has a molecular weight of 275.19 g/mol, XLogP of 1.92, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methyl-1,3-oxazol-5-yl)methyl]-5-(trifluoromethyl)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 138035612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).