C14H18N4OS — CID 138035970
N-[4-(ethylsulfanylmethyl)phenyl]-2-(3-methyltriazol-4-yl)acetamide (PubChem CID 138035970) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is N-[4-(ethylsulfanylmethyl)phenyl]-2-(3-methyltriazol-4-yl)acetamide.
| Compound Name | N-[4-(ethylsulfanylmethyl)phenyl]-2-(3-methyltriazol-4-yl)acetamide |
|---|---|
| PubChem CID | 138035970 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-[4-(ethylsulfanylmethyl)phenyl]-2-(3-methyltriazol-4-yl)acetamide |
| SMILES | CCSCc1ccc(NC(=O)Cc2cnnn2C)cc1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-20-10-11-4-6-12(7-5-11)16-14(19)8-13-9-15-17-18(13)2/h4-7,9H,3,8,10H2,1-2H3,(H,16,19) |
| InChIKey | DRYBDFFMXJZAGH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |