C19H16F2N2O2 — CID 138037874
5-benzyl-3-[(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]imidazolidine-2,4-dione (PubChem CID 138037874) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is 5-benzyl-3-[(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]imidazolidine-2,4-dione.
| Compound Name | 5-benzyl-3-[(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 138037874 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 5-benzyl-3-[(1R,2S)-2-(2,4-difluorophenyl)cyclopropyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(Cc2ccccc2)C(=O)N1[C@@H]1C[C@H]1c1ccc(F)cc1F |
| InChI | InChI=1S/C19H16F2N2O2/c20-12-6-7-13(15(21)9-12)14-10-17(14)23-18(24)16(22-19(23)25)8-11-4-2-1-3-5-11/h1-7,9,14,16-17H,8,10H2,(H,22,25)/t14-,16?,17+/m0/s1 |
| InChIKey | KIICAOHKSFAAHF-DRXWIORDSA-N |
| XLogP | 2.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|