About (3,3-dimethyloxan-4-yl)methanamine;hydrochloride
(3,3-dimethyloxan-4-yl)methanamine;hydrochloride (PubChem CID 138037954) has the molecular formula C8H18ClNO
and a molecular weight of 179.69 g/mol. Its IUPAC name is (3,3-dimethyloxan-4-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (3,3-dimethyloxan-4-yl)methanamine;hydrochloride |
| PubChem CID | 138037954 |
| Molecular Formula | C8H18ClNO |
| Molecular Weight | 179.69 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (3,3-dimethyloxan-4-yl)methanamine;hydrochloride |
| SMILES | CC1(C)COCCC1CN.Cl |
| InChI | InChI=1S/C8H17NO.ClH/c1-8(2)6-10-4-3-7(8)5-9;/h7H,3-6,9H2,1-2H3;1H |
| InChIKey | AUBUUJOBQVWQFO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.69 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,3-dimethyloxan-4-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyloxan-4-yl)methanamine;hydrochloride?
The IUPAC name of (3,3-dimethyloxan-4-yl)methanamine;hydrochloride (CID 138037954) is (3,3-dimethyloxan-4-yl)methanamine;hydrochloride.
What is the SMILES notation for (3,3-dimethyloxan-4-yl)methanamine;hydrochloride?
The canonical SMILES for (3,3-dimethyloxan-4-yl)methanamine;hydrochloride is CC1(C)COCCC1CN.Cl.
What is the InChIKey of (3,3-dimethyloxan-4-yl)methanamine;hydrochloride?
The InChIKey is AUBUUJOBQVWQFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO.ClH/c1-8(2)6-10-4-3-7(8)5-9;/h7H,3-6,9H2,1-2H3;1H.
What are the key properties of (3,3-dimethyloxan-4-yl)methanamine;hydrochloride?
(3,3-dimethyloxan-4-yl)methanamine;hydrochloride has a molecular weight of 179.69 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyloxan-4-yl)methanamine;hydrochloride is sourced from PubChem (CID 138037954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).