C19H24N6OS — CID 138038396
2-[[4-(2,5-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-pyrazol-1-ylpropyl)acetamide (PubChem CID 138038396) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-[[4-(2,5-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-pyrazol-1-ylpropyl)acetamide.
| Compound Name | 2-[[4-(2,5-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-pyrazol-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 138038396 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 2-[[4-(2,5-dimethylphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-pyrazol-1-ylpropyl)acetamide |
| SMILES | Cc1ccc(C)c(-n2c(C)nnc2SCC(=O)NCCCn2cccn2)c1 |
| InChI | InChI=1S/C19H24N6OS/c1-14-6-7-15(2)17(12-14)25-16(3)22-23-19(25)27-13-18(26)20-8-4-10-24-11-5-9-21-24/h5-7,9,11-12H,4,8,10,13H2,1-3H3,(H,20,26) |
| InChIKey | WXJSLUQWKZYAAO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|