C20H16F3N5S — CID 138038597
1-phenyl-5-[[5-phenyl-1-(2,2,2-trifluoroethyl)imidazol-2-yl]sulfanylmethyl]-1,2,4-triazole (PubChem CID 138038597) has the molecular formula C20H16F3N5S and a molecular weight of 415.44 g/mol. Its IUPAC name is 1-phenyl-5-[[5-phenyl-1-(2,2,2-trifluoroethyl)imidazol-2-yl]sulfanylmethyl]-1,2,4-triazole.
| Compound Name | 1-phenyl-5-[[5-phenyl-1-(2,2,2-trifluoroethyl)imidazol-2-yl]sulfanylmethyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 138038597 |
| Molecular Formula | C20H16F3N5S |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 1-phenyl-5-[[5-phenyl-1-(2,2,2-trifluoroethyl)imidazol-2-yl]sulfanylmethyl]-1,2,4-triazole |
| SMILES | FC(F)(F)Cn1c(-c2ccccc2)cnc1SCc1ncnn1-c1ccccc1 |
| InChI | InChI=1S/C20H16F3N5S/c21-20(22,23)13-27-17(15-7-3-1-4-8-15)11-24-19(27)29-12-18-25-14-26-28(18)16-9-5-2-6-10-16/h1-11,14H,12-13H2 |
| InChIKey | ANSSVTHKVSPARF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'} |
|---|