About 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline
8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline (PubChem CID 138038997) has the molecular formula C16H10FN5O
and a molecular weight of 307.29 g/mol. Its IUPAC name is 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline.
Molecular Properties
| Compound Name | 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline |
| PubChem CID | 138038997 |
| Molecular Formula | C16H10FN5O |
| Molecular Weight | 307.29 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline |
| SMILES | Fc1cccc2c(Oc3ccc(-n4cncn4)cc3)ncnc12 |
| InChI | InChI=1S/C16H10FN5O/c17-14-3-1-2-13-15(14)19-9-20-16(13)23-12-6-4-11(5-7-12)22-10-18-8-21-22/h1-10H |
| InChIKey | GJRWUTBORFWMOV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline?
The IUPAC name of 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline (CID 138038997) is 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline.
What is the SMILES notation for 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline?
The canonical SMILES for 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline is Fc1cccc2c(Oc3ccc(-n4cncn4)cc3)ncnc12.
What is the InChIKey of 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline?
The InChIKey is GJRWUTBORFWMOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10FN5O/c17-14-3-1-2-13-15(14)19-9-20-16(13)23-12-6-4-11(5-7-12)22-10-18-8-21-22/h1-10H.
What are the key properties of 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline?
8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline has a molecular weight of 307.29 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-4-[4-(1,2,4-triazol-1-yl)phenoxy]quinazoline is sourced from PubChem (CID 138038997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).