C14H17N3O4S — CID 138039109
N-[4-(2,6-dioxopiperidin-4-yl)phenyl]azetidine-1-sulfonamide (PubChem CID 138039109) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is N-[4-(2,6-dioxopiperidin-4-yl)phenyl]azetidine-1-sulfonamide.
| Compound Name | N-[4-(2,6-dioxopiperidin-4-yl)phenyl]azetidine-1-sulfonamide |
|---|---|
| PubChem CID | 138039109 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[4-(2,6-dioxopiperidin-4-yl)phenyl]azetidine-1-sulfonamide |
| SMILES | O=C1CC(c2ccc(NS(=O)(=O)N3CCC3)cc2)CC(=O)N1 |
| InChI | InChI=1S/C14H17N3O4S/c18-13-8-11(9-14(19)15-13)10-2-4-12(5-3-10)16-22(20,21)17-6-1-7-17/h2-5,11,16H,1,6-9H2,(H,15,18,19) |
| InChIKey | ATDKSRRCEZVVOZ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|