About 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride
3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride (PubChem CID 138039470) has the molecular formula C13H10Cl2FNO2
and a molecular weight of 302.13 g/mol. Its IUPAC name is 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride.
Molecular Properties
| Compound Name | 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride |
| PubChem CID | 138039470 |
| Molecular Formula | C13H10Cl2FNO2 |
| Molecular Weight | 302.13 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride |
| SMILES | Cl.Fc1cncc(-c2cc(CCl)cc3c2OCO3)c1 |
| InChI | InChI=1S/C13H9ClFNO2.ClH/c14-4-8-1-11(9-3-10(15)6-16-5-9)13-12(2-8)17-7-18-13;/h1-3,5-6H,4,7H2;1H |
| InChIKey | OOGAZWVIYRCQIB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.13 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride?
The IUPAC name of 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride (CID 138039470) is 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride.
What is the SMILES notation for 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride?
The canonical SMILES for 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride is Cl.Fc1cncc(-c2cc(CCl)cc3c2OCO3)c1.
What is the InChIKey of 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride?
The InChIKey is OOGAZWVIYRCQIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClFNO2.ClH/c14-4-8-1-11(9-3-10(15)6-16-5-9)13-12(2-8)17-7-18-13;/h1-3,5-6H,4,7H2;1H.
What are the key properties of 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride?
3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride has a molecular weight of 302.13 g/mol, XLogP of 3.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(chloromethyl)-1,3-benzodioxol-4-yl]-5-fluoropyridine;hydrochloride is sourced from PubChem (CID 138039470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).