About (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride
(E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride (PubChem CID 138040013) has the molecular formula C5H6ClN3O2
and a molecular weight of 175.58 g/mol. Its IUPAC name is (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride |
| PubChem CID | 138040013 |
| Molecular Formula | C5H6ClN3O2 |
| Molecular Weight | 175.58 g/mol |
| Exact Mass | 175.01 |
| IUPAC Name | (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride |
| SMILES | Cl.O=C(O)/C=C/c1ncn[nH]1 |
| InChI | InChI=1S/C5H5N3O2.ClH/c9-5(10)2-1-4-6-3-7-8-4;/h1-3H,(H,9,10)(H,6,7,8);1H/b2-1+; |
| InChIKey | CZJNJOGDGWXKJG-TYYBGVCCSA-N |
| XLogP | 0.32 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.58 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride?
The IUPAC name of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride (CID 138040013) is (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride.
What is the SMILES notation for (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride?
The canonical SMILES for (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride is Cl.O=C(O)/C=C/c1ncn[nH]1.
What is the InChIKey of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride?
The InChIKey is CZJNJOGDGWXKJG-TYYBGVCCSA-N. The full InChI is InChI=1S/C5H5N3O2.ClH/c9-5(10)2-1-4-6-3-7-8-4;/h1-3H,(H,9,10)(H,6,7,8);1H/b2-1+;.
What are the key properties of (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride?
(E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride has a molecular weight of 175.58 g/mol, XLogP of 0.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1H-1,2,4-triazol-5-yl)prop-2-enoic acid;hydrochloride is sourced from PubChem (CID 138040013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).