About 1-cyclopropylpyrazole;hydrochloride
1-cyclopropylpyrazole;hydrochloride (PubChem CID 138040072) has the molecular formula C6H9ClN2
and a molecular weight of 144.61 g/mol. Its IUPAC name is 1-cyclopropylpyrazole;hydrochloride.
Molecular Properties
| Compound Name | 1-cyclopropylpyrazole;hydrochloride |
| PubChem CID | 138040072 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.61 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 1-cyclopropylpyrazole;hydrochloride |
| SMILES | Cl.c1cnn(C2CC2)c1 |
| InChI | InChI=1S/C6H8N2.ClH/c1-4-7-8(5-1)6-2-3-6;/h1,4-6H,2-3H2;1H |
| InChIKey | REDZBLWBLUWEES-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.61 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropylpyrazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylpyrazole;hydrochloride?
The IUPAC name of 1-cyclopropylpyrazole;hydrochloride (CID 138040072) is 1-cyclopropylpyrazole;hydrochloride.
What is the SMILES notation for 1-cyclopropylpyrazole;hydrochloride?
The canonical SMILES for 1-cyclopropylpyrazole;hydrochloride is Cl.c1cnn(C2CC2)c1.
What is the InChIKey of 1-cyclopropylpyrazole;hydrochloride?
The InChIKey is REDZBLWBLUWEES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.ClH/c1-4-7-8(5-1)6-2-3-6;/h1,4-6H,2-3H2;1H.
What are the key properties of 1-cyclopropylpyrazole;hydrochloride?
1-cyclopropylpyrazole;hydrochloride has a molecular weight of 144.61 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpyrazole;hydrochloride is sourced from PubChem (CID 138040072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).