About (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride
(1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride (PubChem CID 138040122) has the molecular formula C5H10ClN3O
and a molecular weight of 163.61 g/mol. Its IUPAC name is (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride.
Molecular Properties
| Compound Name | (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride |
| PubChem CID | 138040122 |
| Molecular Formula | C5H10ClN3O |
| Molecular Weight | 163.61 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride |
| SMILES | Cc1nc([C@H](C)O)n[nH]1.Cl |
| InChI | InChI=1S/C5H9N3O.ClH/c1-3(9)5-6-4(2)7-8-5;/h3,9H,1-2H3,(H,6,7,8);1H/t3-;/m0./s1 |
| InChIKey | JGAUMUPKSNWDFS-DFWYDOINSA-N |
| XLogP | 0.59 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.61 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
The IUPAC name of (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride (CID 138040122) is (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride.
What is the SMILES notation for (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
The canonical SMILES for (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride is Cc1nc([C@H](C)O)n[nH]1.Cl.
What is the InChIKey of (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
The InChIKey is JGAUMUPKSNWDFS-DFWYDOINSA-N. The full InChI is InChI=1S/C5H9N3O.ClH/c1-3(9)5-6-4(2)7-8-5;/h3,9H,1-2H3,(H,6,7,8);1H/t3-;/m0./s1.
What are the key properties of (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride?
(1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride has a molecular weight of 163.61 g/mol, XLogP of 0.59, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-(5-methyl-1H-1,2,4-triazol-3-yl)ethanol;hydrochloride is sourced from PubChem (CID 138040122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).