About 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride
3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride (PubChem CID 138040267) has the molecular formula C8H10ClN3OS
and a molecular weight of 231.71 g/mol. Its IUPAC name is 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride.
Molecular Properties
| Compound Name | 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride |
| PubChem CID | 138040267 |
| Molecular Formula | C8H10ClN3OS |
| Molecular Weight | 231.71 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride |
| SMILES | Cl.NCCn1cnc2sccc2c1=O |
| InChI | InChI=1S/C8H9N3OS.ClH/c9-2-3-11-5-10-7-6(8(11)12)1-4-13-7;/h1,4-5H,2-3,9H2;1H |
| InChIKey | PDQRGTIYWZUPRV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.71 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride?
The IUPAC name of 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride (CID 138040267) is 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride.
What is the SMILES notation for 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride?
The canonical SMILES for 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride is Cl.NCCn1cnc2sccc2c1=O.
What is the InChIKey of 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride?
The InChIKey is PDQRGTIYWZUPRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS.ClH/c9-2-3-11-5-10-7-6(8(11)12)1-4-13-7;/h1,4-5H,2-3,9H2;1H.
What are the key properties of 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride?
3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride has a molecular weight of 231.71 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethyl)thieno[2,3-d]pyrimidin-4-one;hydrochloride is sourced from PubChem (CID 138040267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).