About 4-piperidin-3-ylphenol;hydrochloride
4-piperidin-3-ylphenol;hydrochloride (PubChem CID 138040420) has the molecular formula C11H16ClNO
and a molecular weight of 213.71 g/mol. Its IUPAC name is 4-piperidin-3-ylphenol;hydrochloride.
Molecular Properties
| Compound Name | 4-piperidin-3-ylphenol;hydrochloride |
| PubChem CID | 138040420 |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-piperidin-3-ylphenol;hydrochloride |
| SMILES | Cl.Oc1ccc(C2CCCNC2)cc1 |
| InChI | InChI=1S/C11H15NO.ClH/c13-11-5-3-9(4-6-11)10-2-1-7-12-8-10;/h3-6,10,12-13H,1-2,7-8H2;1H |
| InChIKey | WZRJBQSXAKPAKW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-piperidin-3-ylphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperidin-3-ylphenol;hydrochloride?
The IUPAC name of 4-piperidin-3-ylphenol;hydrochloride (CID 138040420) is 4-piperidin-3-ylphenol;hydrochloride.
What is the SMILES notation for 4-piperidin-3-ylphenol;hydrochloride?
The canonical SMILES for 4-piperidin-3-ylphenol;hydrochloride is Cl.Oc1ccc(C2CCCNC2)cc1.
What is the InChIKey of 4-piperidin-3-ylphenol;hydrochloride?
The InChIKey is WZRJBQSXAKPAKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.ClH/c13-11-5-3-9(4-6-11)10-2-1-7-12-8-10;/h3-6,10,12-13H,1-2,7-8H2;1H.
What are the key properties of 4-piperidin-3-ylphenol;hydrochloride?
4-piperidin-3-ylphenol;hydrochloride has a molecular weight of 213.71 g/mol, XLogP of 2.28, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperidin-3-ylphenol;hydrochloride is sourced from PubChem (CID 138040420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).