About acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine
acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine (PubChem CID 138040470) has the molecular formula C9H11F3N2O2
and a molecular weight of 236.19 g/mol. Its IUPAC name is acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine |
| PubChem CID | 138040470 |
| Molecular Formula | C9H11F3N2O2 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine |
| SMILES | CC(=O)O.NCc1cccnc1C(F)(F)F |
| InChI | InChI=1S/C7H7F3N2.C2H4O2/c8-7(9,10)6-5(4-11)2-1-3-12-6;1-2(3)4/h1-3H,4,11H2;1H3,(H,3,4) |
| InChIKey | BLGPRSKPIZDSRL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine?
The IUPAC name of acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine (CID 138040470) is acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine.
What is the SMILES notation for acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine?
The canonical SMILES for acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine is CC(=O)O.NCc1cccnc1C(F)(F)F.
What is the InChIKey of acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine?
The InChIKey is BLGPRSKPIZDSRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F3N2.C2H4O2/c8-7(9,10)6-5(4-11)2-1-3-12-6;1-2(3)4/h1-3H,4,11H2;1H3,(H,3,4).
What are the key properties of acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine?
acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine has a molecular weight of 236.19 g/mol, XLogP of 1.65, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;[2-(trifluoromethyl)-3-pyridinyl]methanamine is sourced from PubChem (CID 138040470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).