About lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate
lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate (PubChem CID 138040570) has the molecular formula C7H9LiN2O3S
and a molecular weight of 208.17 g/mol. Its IUPAC name is lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate |
| PubChem CID | 138040570 |
| Molecular Formula | C7H9LiN2O3S |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate |
| SMILES | COCCNc1ncc(C(=O)[O-])s1.[Li+] |
| InChI | InChI=1S/C7H10N2O3S.Li/c1-12-3-2-8-7-9-4-5(13-7)6(10)11;/h4H,2-3H2,1H3,(H,8,9)(H,10,11);/q;+1/p-1 |
| InChIKey | KRBRQQRLXXJVQE-UHFFFAOYSA-M |
| XLogP | -3.43 |
| TPSA | 74.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate?
The IUPAC name of lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate (CID 138040570) is lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate.
What is the SMILES notation for lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate?
The canonical SMILES for lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate is COCCNc1ncc(C(=O)[O-])s1.[Li+].
What is the InChIKey of lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate?
The InChIKey is KRBRQQRLXXJVQE-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H10N2O3S.Li/c1-12-3-2-8-7-9-4-5(13-7)6(10)11;/h4H,2-3H2,1H3,(H,8,9)(H,10,11);/q;+1/p-1.
What are the key properties of lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate?
lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate has a molecular weight of 208.17 g/mol, XLogP of -3.43, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-(2-methoxyethylamino)-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 138040570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).