About lithium 2-ethyl-1,2,4-triazole-3-carboxylate
lithium 2-ethyl-1,2,4-triazole-3-carboxylate (PubChem CID 138040722) has the molecular formula C5H6LiN3O2
and a molecular weight of 147.06 g/mol. Its IUPAC name is lithium 2-ethyl-1,2,4-triazole-3-carboxylate.
Molecular Properties
| Compound Name | lithium 2-ethyl-1,2,4-triazole-3-carboxylate |
| PubChem CID | 138040722 |
| Molecular Formula | C5H6LiN3O2 |
| Molecular Weight | 147.06 g/mol |
| Exact Mass | 147.06 |
| IUPAC Name | lithium 2-ethyl-1,2,4-triazole-3-carboxylate |
| SMILES | CCn1ncnc1C(=O)[O-].[Li+] |
| InChI | InChI=1S/C5H7N3O2.Li/c1-2-8-4(5(9)10)6-3-7-8;/h3H,2H2,1H3,(H,9,10);/q;+1/p-1 |
| InChIKey | XJIIKOXXSFVCMN-UHFFFAOYSA-M |
| XLogP | -4.33 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.06 |
| LogP ≤ 5 | -4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze lithium 2-ethyl-1,2,4-triazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium 2-ethyl-1,2,4-triazole-3-carboxylate?
The IUPAC name of lithium 2-ethyl-1,2,4-triazole-3-carboxylate (CID 138040722) is lithium 2-ethyl-1,2,4-triazole-3-carboxylate.
What is the SMILES notation for lithium 2-ethyl-1,2,4-triazole-3-carboxylate?
The canonical SMILES for lithium 2-ethyl-1,2,4-triazole-3-carboxylate is CCn1ncnc1C(=O)[O-].[Li+].
What is the InChIKey of lithium 2-ethyl-1,2,4-triazole-3-carboxylate?
The InChIKey is XJIIKOXXSFVCMN-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H7N3O2.Li/c1-2-8-4(5(9)10)6-3-7-8;/h3H,2H2,1H3,(H,9,10);/q;+1/p-1.
What are the key properties of lithium 2-ethyl-1,2,4-triazole-3-carboxylate?
lithium 2-ethyl-1,2,4-triazole-3-carboxylate has a molecular weight of 147.06 g/mol, XLogP of -4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for lithium 2-ethyl-1,2,4-triazole-3-carboxylate is sourced from PubChem (CID 138040722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).