About 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride
3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride (PubChem CID 138040786) has the molecular formula C8H9Cl2N3O2
and a molecular weight of 250.09 g/mol. Its IUPAC name is 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride.
Molecular Properties
| Compound Name | 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride |
| PubChem CID | 138040786 |
| Molecular Formula | C8H9Cl2N3O2 |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.01 |
| IUPAC Name | 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride |
| SMILES | Cl.Cl.Cn1cnc2cc(C(=O)O)ncc21 |
| InChI | InChI=1S/C8H7N3O2.2ClH/c1-11-4-10-5-2-6(8(12)13)9-3-7(5)11;;/h2-4H,1H3,(H,12,13);2*1H |
| InChIKey | MVJXKQMWULDYJJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride?
The IUPAC name of 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride (CID 138040786) is 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride.
What is the SMILES notation for 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride?
The canonical SMILES for 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride is Cl.Cl.Cn1cnc2cc(C(=O)O)ncc21.
What is the InChIKey of 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride?
The InChIKey is MVJXKQMWULDYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2.2ClH/c1-11-4-10-5-2-6(8(12)13)9-3-7(5)11;;/h2-4H,1H3,(H,12,13);2*1H.
What are the key properties of 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride?
3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride has a molecular weight of 250.09 g/mol, XLogP of 1.51, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylimidazo[4,5-c]pyridine-6-carboxylic acid;dihydrochloride is sourced from PubChem (CID 138040786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).